C31H34N2O4 — CID 23919638
[(4S,5S)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-5H-1,3-oxazol-4-yl]-piperidin-1-ylmethanone (PubChem CID 23919638) has the molecular formula C31H34N2O4 and a molecular weight of 498.62 g/mol. Its IUPAC name is [(4S,5S)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-5H-1,3-oxazol-4-yl]-piperidin-1-ylmethanone.
| Compound Name | [(4S,5S)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-5H-1,3-oxazol-4-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 23919638 |
| Molecular Formula | C31H34N2O4 |
| Molecular Weight | 498.62 g/mol |
| Exact Mass | 498.25 |
| IUPAC Name | [(4S,5S)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5-phenyl-5H-1,3-oxazol-4-yl]-piperidin-1-ylmethanone |
| SMILES | O=C(N1CCCCC1)[C@@]1(Cc2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C31H34N2O4/c34-21-10-22-36-27-17-15-26(16-18-27)29-32-31(23-24-11-4-1-5-12-24,30(35)33-19-8-3-9-20-33)28(37-29)25-13-6-2-7-14-25/h1-2,4-7,11-18,28,34H,3,8-10,19-23H2/t28-,31-/m0/s1 |
| InChIKey | LOOZCASRFRGQBE-IZEXYCQBSA-N |
| XLogP | 4.96 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.62 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|