C33H36N2O4 — CID 23778373
[(4R,5R)-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-4-prop-2-enyl-5H-1,3-oxazol-4-yl]-piperidin-1-ylmethanone (PubChem CID 23778373) has the molecular formula C33H36N2O4 and a molecular weight of 524.66 g/mol. Its IUPAC name is [(4R,5R)-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-4-prop-2-enyl-5H-1,3-oxazol-4-yl]-piperidin-1-ylmethanone.
| Compound Name | [(4R,5R)-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-4-prop-2-enyl-5H-1,3-oxazol-4-yl]-piperidin-1-ylmethanone |
|---|---|
| PubChem CID | 23778373 |
| Molecular Formula | C33H36N2O4 |
| Molecular Weight | 524.66 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | [(4R,5R)-2-[4-(3-hydroxypropoxy)phenyl]-5-(4-phenylphenyl)-4-prop-2-enyl-5H-1,3-oxazol-4-yl]-piperidin-1-ylmethanone |
| SMILES | C=CC[C@@]1(C(=O)N2CCCCC2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C33H36N2O4/c1-2-20-33(32(37)35-21-7-4-8-22-35)30(27-14-12-26(13-15-27)25-10-5-3-6-11-25)39-31(34-33)28-16-18-29(19-17-28)38-24-9-23-36/h2-3,5-6,10-19,30,36H,1,4,7-9,20-24H2/t30-,33-/m1/s1 |
| InChIKey | WSIMJFRIKFNGFV-LXANVCGNSA-N |
| XLogP | 5.96 |
| TPSA | 71.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.66 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|