C32H37N3O5 — CID 24868511
(4R,5R)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-N-(2-morpholin-4-ylethyl)-5-phenyl-5H-1,3-oxazole-4-carboxamide (PubChem CID 24868511) has the molecular formula C32H37N3O5 and a molecular weight of 543.66 g/mol. Its IUPAC name is (4R,5R)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-N-(2-morpholin-4-ylethyl)-5-phenyl-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-N-(2-morpholin-4-ylethyl)-5-phenyl-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 24868511 |
| Molecular Formula | C32H37N3O5 |
| Molecular Weight | 543.66 g/mol |
| Exact Mass | 543.27 |
| IUPAC Name | (4R,5R)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-N-(2-morpholin-4-ylethyl)-5-phenyl-5H-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NCCN1CCOCC1)[C@]1(Cc2ccccc2)N=C(c2ccc(OCCCO)cc2)O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C32H37N3O5/c36-20-7-21-39-28-14-12-27(13-15-28)30-34-32(24-25-8-3-1-4-9-25,29(40-30)26-10-5-2-6-11-26)31(37)33-16-17-35-18-22-38-23-19-35/h1-6,8-15,29,36H,7,16-24H2,(H,33,37)/t29-,32-/m1/s1 |
| InChIKey | YLXWXGNIEBHABW-QLWXXVCSSA-N |
| XLogP | 3.40 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.66 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|