C36H41N5O5 — CID 23947967
(4R,5R)-5-[2-(azidomethyl)phenyl]-N-[(1-hydroxycyclohexyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carboxamide (PubChem CID 23947967) has the molecular formula C36H41N5O5 and a molecular weight of 623.75 g/mol. Its IUPAC name is (4R,5R)-5-[2-(azidomethyl)phenyl]-N-[(1-hydroxycyclohexyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-5-[2-(azidomethyl)phenyl]-N-[(1-hydroxycyclohexyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23947967 |
| Molecular Formula | C36H41N5O5 |
| Molecular Weight | 623.75 g/mol |
| Exact Mass | 623.31 |
| IUPAC Name | (4R,5R)-5-[2-(azidomethyl)phenyl]-N-[(1-hydroxycyclohexyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-4-[(E)-3-phenylprop-2-enyl]-5H-1,3-oxazole-4-carboxamide |
| SMILES | [N-]=[N+]=NCc1ccccc1[C@H]1OC(c2ccc(OCCCO)cc2)=N[C@@]1(C/C=C/c1ccccc1)C(=O)NCC1(O)CCCCC1 |
| InChI | InChI=1S/C36H41N5O5/c37-41-39-25-29-14-5-6-15-31(29)32-36(22-9-13-27-11-3-1-4-12-27,34(43)38-26-35(44)20-7-2-8-21-35)40-33(46-32)28-16-18-30(19-17-28)45-24-10-23-42/h1,3-6,9,11-19,32,42,44H,2,7-8,10,20-26H2,(H,38,43)/b13-9+/t32-,36-/m1/s1 |
| InChIKey | AYKFUHPTYFKNJX-VUEPGYGQSA-N |
| XLogP | 6.43 |
| TPSA | 149.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.75 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|