C32H36Cl2N6O5 — CID 23863418
(4S,5S)-4-[(2-azidophenyl)methyl]-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N'-(3-propan-2-yloxypropyl)-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23863418) has the molecular formula C32H36Cl2N6O5 and a molecular weight of 655.58 g/mol. Its IUPAC name is (4S,5S)-4-[(2-azidophenyl)methyl]-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N'-(3-propan-2-yloxypropyl)-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[(2-azidophenyl)methyl]-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N'-(3-propan-2-yloxypropyl)-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23863418 |
| Molecular Formula | C32H36Cl2N6O5 |
| Molecular Weight | 655.58 g/mol |
| Exact Mass | 654.21 |
| IUPAC Name | (4S,5S)-4-[(2-azidophenyl)methyl]-5-(2,4-dichlorophenyl)-2-[4-(3-hydroxypropoxy)phenyl]-N'-(3-propan-2-yloxypropyl)-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | CC(C)OCCCNNC(=O)[C@@]1(Cc2ccccc2N=[N+]=[N-])N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C32H36Cl2N6O5/c1-21(2)43-17-5-15-36-39-31(42)32(20-23-7-3-4-8-28(23)38-40-35)29(26-14-11-24(33)19-27(26)34)45-30(37-32)22-9-12-25(13-10-22)44-18-6-16-41/h3-4,7-14,19,21,29,36,41H,5-6,15-18,20H2,1-2H3,(H,39,42)/t29-,32-/m0/s1 |
| InChIKey | WWONJKMVDKIDHS-NYDCQLBNSA-N |
| XLogP | 6.63 |
| TPSA | 150.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.58 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|