C33H39N5O6 — CID 23864392
(4R,5R)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N-(3-propan-2-yloxypropyl)-5H-1,3-oxazole-4-carboxamide (PubChem CID 23864392) has the molecular formula C33H39N5O6 and a molecular weight of 601.70 g/mol. Its IUPAC name is (4R,5R)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N-(3-propan-2-yloxypropyl)-5H-1,3-oxazole-4-carboxamide.
| Compound Name | (4R,5R)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N-(3-propan-2-yloxypropyl)-5H-1,3-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 23864392 |
| Molecular Formula | C33H39N5O6 |
| Molecular Weight | 601.70 g/mol |
| Exact Mass | 601.29 |
| IUPAC Name | (4R,5R)-4-[(2-azidophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5-(3-methoxyphenyl)-N-(3-propan-2-yloxypropyl)-5H-1,3-oxazole-4-carboxamide |
| SMILES | COc1cccc([C@H]2OC(c3ccc(OCCCO)cc3)=N[C@@]2(Cc2ccccc2N=[N+]=[N-])C(=O)NCCCOC(C)C)c1 |
| InChI | InChI=1S/C33H39N5O6/c1-23(2)42-19-7-17-35-32(40)33(22-26-9-4-5-12-29(26)37-38-34)30(25-10-6-11-28(21-25)41-3)44-31(36-33)24-13-15-27(16-14-24)43-20-8-18-39/h4-6,9-16,21,23,30,39H,7-8,17-20,22H2,1-3H3,(H,35,40)/t30-,33-/m1/s1 |
| InChIKey | PEHMMNTVKXUWLS-LXANVCGNSA-N |
| XLogP | 5.83 |
| TPSA | 147.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.70 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|