C39H32Cl2N6O4 — CID 23806397
(4S,5S)-4-[(2-azidophenyl)methyl]-5-(2,4-dichlorophenyl)-N'-(9H-fluoren-9-yl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23806397) has the molecular formula C39H32Cl2N6O4 and a molecular weight of 719.63 g/mol. Its IUPAC name is (4S,5S)-4-[(2-azidophenyl)methyl]-5-(2,4-dichlorophenyl)-N'-(9H-fluoren-9-yl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-4-[(2-azidophenyl)methyl]-5-(2,4-dichlorophenyl)-N'-(9H-fluoren-9-yl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23806397 |
| Molecular Formula | C39H32Cl2N6O4 |
| Molecular Weight | 719.63 g/mol |
| Exact Mass | 718.19 |
| IUPAC Name | (4S,5S)-4-[(2-azidophenyl)methyl]-5-(2,4-dichlorophenyl)-N'-(9H-fluoren-9-yl)-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | [N-]=[N+]=Nc1ccccc1C[C@]1(C(=O)NNC2c3ccccc3-c3ccccc32)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C39H32Cl2N6O4/c40-26-16-19-32(33(41)22-26)36-39(23-25-8-1-6-13-34(25)44-47-42,43-37(51-36)24-14-17-27(18-15-24)50-21-7-20-48)38(49)46-45-35-30-11-4-2-9-28(30)29-10-3-5-12-31(29)35/h1-6,8-19,22,35-36,45,48H,7,20-21,23H2,(H,46,49)/t36-,39-/m0/s1 |
| InChIKey | XGQHHZJPORFTDK-VQIIKMDRSA-N |
| XLogP | 8.59 |
| TPSA | 140.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 719.63 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|