C34H32N6O6 — CID 23864051
(4S,5S)-5-(2-azidophenyl)-N'-(1,3-benzodioxol-5-ylmethyl)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23864051) has the molecular formula C34H32N6O6 and a molecular weight of 620.67 g/mol. Its IUPAC name is (4S,5S)-5-(2-azidophenyl)-N'-(1,3-benzodioxol-5-ylmethyl)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-5-(2-azidophenyl)-N'-(1,3-benzodioxol-5-ylmethyl)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23864051 |
| Molecular Formula | C34H32N6O6 |
| Molecular Weight | 620.67 g/mol |
| Exact Mass | 620.24 |
| IUPAC Name | (4S,5S)-5-(2-azidophenyl)-N'-(1,3-benzodioxol-5-ylmethyl)-4-benzyl-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | [N-]=[N+]=Nc1ccccc1[C@@H]1OC(c2ccc(OCCCO)cc2)=N[C@]1(Cc1ccccc1)C(=O)NNCc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C34H32N6O6/c35-40-38-28-10-5-4-9-27(28)31-34(20-23-7-2-1-3-8-23,33(42)39-36-21-24-11-16-29-30(19-24)45-22-44-29)37-32(46-31)25-12-14-26(15-13-25)43-18-6-17-41/h1-5,7-16,19,31,36,41H,6,17-18,20-22H2,(H,39,42)/t31-,34-/m0/s1 |
| InChIKey | FDWOQUMGKGOXAE-VBTAUBHQSA-N |
| XLogP | 5.44 |
| TPSA | 159.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.67 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|