C34H31Br2N3O6 — CID 23891708
(4S,5S)-N'-(1,3-benzodioxol-5-ylmethyl)-5-(4-bromophenyl)-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23891708) has the molecular formula C34H31Br2N3O6 and a molecular weight of 737.44 g/mol. Its IUPAC name is (4S,5S)-N'-(1,3-benzodioxol-5-ylmethyl)-5-(4-bromophenyl)-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-N'-(1,3-benzodioxol-5-ylmethyl)-5-(4-bromophenyl)-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23891708 |
| Molecular Formula | C34H31Br2N3O6 |
| Molecular Weight | 737.44 g/mol |
| Exact Mass | 735.06 |
| IUPAC Name | (4S,5S)-N'-(1,3-benzodioxol-5-ylmethyl)-5-(4-bromophenyl)-4-[(4-bromophenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | O=C(NNCc1ccc2c(c1)OCO2)[C@@]1(Cc2ccc(Br)cc2)N=C(c2ccc(OCCCO)cc2)O[C@H]1c1ccc(Br)cc1 |
| InChI | InChI=1S/C34H31Br2N3O6/c35-26-9-2-22(3-10-26)19-34(33(41)39-37-20-23-4-15-29-30(18-23)44-21-43-29)31(24-5-11-27(36)12-6-24)45-32(38-34)25-7-13-28(14-8-25)42-17-1-16-40/h2-15,18,31,37,40H,1,16-17,19-21H2,(H,39,41)/t31-,34-/m0/s1 |
| InChIKey | GRPVDVGJTRQXHL-VBTAUBHQSA-N |
| XLogP | 6.02 |
| TPSA | 110.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 737.44 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|