C36H37N9O6 — CID 23748835
(4S,5S)-5-[2-(azidomethyl)phenyl]-4-[(2-azidophenyl)methyl]-N'-[(2,3-dimethoxyphenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide (PubChem CID 23748835) has the molecular formula C36H37N9O6 and a molecular weight of 691.75 g/mol. Its IUPAC name is (4S,5S)-5-[2-(azidomethyl)phenyl]-4-[(2-azidophenyl)methyl]-N'-[(2,3-dimethoxyphenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide.
| Compound Name | (4S,5S)-5-[2-(azidomethyl)phenyl]-4-[(2-azidophenyl)methyl]-N'-[(2,3-dimethoxyphenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
|---|---|
| PubChem CID | 23748835 |
| Molecular Formula | C36H37N9O6 |
| Molecular Weight | 691.75 g/mol |
| Exact Mass | 691.29 |
| IUPAC Name | (4S,5S)-5-[2-(azidomethyl)phenyl]-4-[(2-azidophenyl)methyl]-N'-[(2,3-dimethoxyphenyl)methyl]-2-[4-(3-hydroxypropoxy)phenyl]-5H-1,3-oxazole-4-carbohydrazide |
| SMILES | COc1cccc(CNNC(=O)[C@@]2(Cc3ccccc3N=[N+]=[N-])N=C(c3ccc(OCCCO)cc3)O[C@H]2c2ccccc2CN=[N+]=[N-])c1OC |
| InChI | InChI=1S/C36H37N9O6/c1-48-31-14-7-11-27(32(31)49-2)23-39-43-35(47)36(21-25-9-4-6-13-30(25)42-45-38)33(29-12-5-3-10-26(29)22-40-44-37)51-34(41-36)24-15-17-28(18-16-24)50-20-8-19-46/h3-7,9-18,33,39,46H,8,19-23H2,1-2H3,(H,43,47)/t33-,36-/m0/s1 |
| InChIKey | AKTBMSRLHIJMSC-JUKUECOXSA-N |
| XLogP | 6.54 |
| TPSA | 208.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.75 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|