C29H31N4O4+ — CID 160578981
[2-[[(4R,5R)-2-(4-butoxyphenyl)-4-methoxycarbonyl-5-phenyl-5H-1,3-oxazol-4-yl]methyl]phenyl]methylimino-iminoazanium (PubChem CID 160578981) has the molecular formula C29H31N4O4+ and a molecular weight of 499.59 g/mol. Its IUPAC name is [2-[[(4R,5R)-2-(4-butoxyphenyl)-4-methoxycarbonyl-5-phenyl-5H-1,3-oxazol-4-yl]methyl]phenyl]methylimino-iminoazanium.
| Compound Name | [2-[[(4R,5R)-2-(4-butoxyphenyl)-4-methoxycarbonyl-5-phenyl-5H-1,3-oxazol-4-yl]methyl]phenyl]methylimino-iminoazanium |
|---|---|
| PubChem CID | 160578981 |
| Molecular Formula | C29H31N4O4+ |
| Molecular Weight | 499.59 g/mol |
| Exact Mass | 499.23 |
| IUPAC Name | [2-[[(4R,5R)-2-(4-butoxyphenyl)-4-methoxycarbonyl-5-phenyl-5H-1,3-oxazol-4-yl]methyl]phenyl]methylimino-iminoazanium |
| SMILES | CCCCOc1ccc(C2=N[C@@](Cc3ccccc3CN=[N+]=N)(C(=O)OC)[C@@H](c3ccccc3)O2)cc1 |
| InChI | InChI=1S/C29H31N4O4/c1-3-4-18-36-25-16-14-22(15-17-25)27-32-29(28(34)35-2,26(37-27)21-10-6-5-7-11-21)19-23-12-8-9-13-24(23)20-31-33-30/h5-17,26,30H,3-4,18-20H2,1-2H3/q+1/t26-,29-/m1/s1 |
| InChIKey | WIONZACYIJGUQE-GGXMVOPNSA-N |
| XLogP | 5.59 |
| TPSA | 107.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.59 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|