C21H11F18O3P — CID 13183601
2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2,2-diphenyl-4,4,5,5-tetrakis(trifluoromethyl)-1,3,2lambda5-dioxaphospholane (PubChem CID 13183601) has the molecular formula C21H11F18O3P and a molecular weight of 684.25 g/mol. Its IUPAC name is 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2,2-diphenyl-4,4,5,5-tetrakis(trifluoromethyl)-1,3,2lambda5-dioxaphospholane.
| Compound Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2,2-diphenyl-4,4,5,5-tetrakis(trifluoromethyl)-1,3,2lambda5-dioxaphospholane |
|---|---|
| PubChem CID | 13183601 |
| Molecular Formula | C21H11F18O3P |
| Molecular Weight | 684.25 g/mol |
| Exact Mass | 684.02 |
| IUPAC Name | 2-(1,1,1,3,3,3-hexafluoropropan-2-yloxy)-2,2-diphenyl-4,4,5,5-tetrakis(trifluoromethyl)-1,3,2lambda5-dioxaphospholane |
| SMILES | FC(F)(F)C(OP1(c2ccccc2)(c2ccccc2)OC(C(F)(F)F)(C(F)(F)F)C(C(F)(F)F)(C(F)(F)F)O1)C(F)(F)F |
| InChI | InChI=1S/C21H11F18O3P/c22-14(23,24)13(15(25,26)27)40-43(11-7-3-1-4-8-11,12-9-5-2-6-10-12)41-16(18(28,29)30,19(31,32)33)17(42-43,20(34,35)36)21(37,38)39/h1-10,13H |
| InChIKey | JLYALIBRIRVWGG-UHFFFAOYSA-N |
| XLogP | 8.22 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.25 |
| LogP ≤ 5 | 8.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|