C16H18O4 — CID 11832593
(7Z)-2,13-dioxabicyclo[12.4.0]octadeca-1(18),7,14,16-tetraene-3,12-dione (PubChem CID 11832593) has the molecular formula C16H18O4 and a molecular weight of 274.32 g/mol. Its IUPAC name is (7Z)-2,13-dioxabicyclo[12.4.0]octadeca-1(18),7,14,16-tetraene-3,12-dione.
| Compound Name | (7Z)-2,13-dioxabicyclo[12.4.0]octadeca-1(18),7,14,16-tetraene-3,12-dione |
|---|---|
| PubChem CID | 11832593 |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | (7Z)-2,13-dioxabicyclo[12.4.0]octadeca-1(18),7,14,16-tetraene-3,12-dione |
| SMILES | O=C1CCC/C=C\CCCC(=O)Oc2ccccc2O1 |
| InChI | InChI=1S/C16H18O4/c17-15-11-5-3-1-2-4-6-12-16(18)20-14-10-8-7-9-13(14)19-15/h1-2,7-10H,3-6,11-12H2/b2-1- |
| InChIKey | AKCLDJQNPBVIPG-UPHRSURJSA-N |
| XLogP | 3.41 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|