About 1-oxacycloundec-8-ene-2,11-dione
1-oxacycloundec-8-ene-2,11-dione (PubChem CID 175246292) has the molecular formula C10H14O3
and a molecular weight of 182.22 g/mol. Its IUPAC name is 1-oxacycloundec-8-ene-2,11-dione.
Molecular Properties
| Compound Name | 1-oxacycloundec-8-ene-2,11-dione |
| PubChem CID | 175246292 |
| Molecular Formula | C10H14O3 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.09 |
| IUPAC Name | 1-oxacycloundec-8-ene-2,11-dione |
| SMILES | O=C1CC=CCCCCCC(=O)O1 |
| InChI | InChI=1S/C10H14O3/c11-9-7-5-3-1-2-4-6-8-10(12)13-9/h3,5H,1-2,4,6-8H2 |
| InChIKey | AGFCKHJUUZBLJR-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-oxacycloundec-8-ene-2,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-oxacycloundec-8-ene-2,11-dione?
The IUPAC name of 1-oxacycloundec-8-ene-2,11-dione (CID 175246292) is 1-oxacycloundec-8-ene-2,11-dione.
What is the SMILES notation for 1-oxacycloundec-8-ene-2,11-dione?
The canonical SMILES for 1-oxacycloundec-8-ene-2,11-dione is O=C1CC=CCCCCCC(=O)O1.
What is the InChIKey of 1-oxacycloundec-8-ene-2,11-dione?
The InChIKey is AGFCKHJUUZBLJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O3/c11-9-7-5-3-1-2-4-6-8-10(12)13-9/h3,5H,1-2,4,6-8H2.
What are the key properties of 1-oxacycloundec-8-ene-2,11-dione?
1-oxacycloundec-8-ene-2,11-dione has a molecular weight of 182.22 g/mol, XLogP of 1.97, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-oxacycloundec-8-ene-2,11-dione is sourced from PubChem (CID 175246292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).