C9H8O2S — CID 18970500
4,5-dihydro-2,1-benzoxathiepin-3-one (PubChem CID 18970500) has the molecular formula C9H8O2S and a molecular weight of 180.23 g/mol. Its IUPAC name is 4,5-dihydro-2,1-benzoxathiepin-3-one.
| Compound Name | 4,5-dihydro-2,1-benzoxathiepin-3-one |
|---|---|
| PubChem CID | 18970500 |
| Molecular Formula | C9H8O2S |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.02 |
| IUPAC Name | 4,5-dihydro-2,1-benzoxathiepin-3-one |
| SMILES | O=C1CCc2ccccc2SO1 |
| InChI | InChI=1S/C9H8O2S/c10-9-6-5-7-3-1-2-4-8(7)12-11-9/h1-4H,5-6H2 |
| InChIKey | KAGVPKXIFXNWDB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|