About 4,5-dihydro-2,1-benzoxathiepin-3-one
4,5-dihydro-2,1-benzoxathiepin-3-one (PubChem CID 18970500) has the molecular formula C9H8O2S
and a molecular weight of 180.23 g/mol. Its IUPAC name is 4,5-dihydro-2,1-benzoxathiepin-3-one.
Molecular Properties
| Compound Name | 4,5-dihydro-2,1-benzoxathiepin-3-one |
| PubChem CID | 18970500 |
| Molecular Formula | C9H8O2S |
| Molecular Weight | 180.23 g/mol |
| Exact Mass | 180.02 |
| IUPAC Name | 4,5-dihydro-2,1-benzoxathiepin-3-one |
| SMILES | O=C1CCc2ccccc2SO1 |
| InChI | InChI=1S/C9H8O2S/c10-9-6-5-7-3-1-2-4-8(7)12-11-9/h1-4H,5-6H2 |
| InChIKey | KAGVPKXIFXNWDB-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.23 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,5-dihydro-2,1-benzoxathiepin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-dihydro-2,1-benzoxathiepin-3-one?
The IUPAC name of 4,5-dihydro-2,1-benzoxathiepin-3-one (CID 18970500) is 4,5-dihydro-2,1-benzoxathiepin-3-one.
What is the SMILES notation for 4,5-dihydro-2,1-benzoxathiepin-3-one?
The canonical SMILES for 4,5-dihydro-2,1-benzoxathiepin-3-one is O=C1CCc2ccccc2SO1.
What is the InChIKey of 4,5-dihydro-2,1-benzoxathiepin-3-one?
The InChIKey is KAGVPKXIFXNWDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O2S/c10-9-6-5-7-3-1-2-4-8(7)12-11-9/h1-4H,5-6H2.
What are the key properties of 4,5-dihydro-2,1-benzoxathiepin-3-one?
4,5-dihydro-2,1-benzoxathiepin-3-one has a molecular weight of 180.23 g/mol, XLogP of 2.18, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydro-2,1-benzoxathiepin-3-one is sourced from PubChem (CID 18970500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).