C9H10OS — CID 23450714
3,4-dihydro-2H-thiochromen-2-ol (PubChem CID 23450714) has the molecular formula C9H10OS and a molecular weight of 166.25 g/mol. Its IUPAC name is 3,4-dihydro-2H-thiochromen-2-ol.
| Compound Name | 3,4-dihydro-2H-thiochromen-2-ol |
|---|---|
| PubChem CID | 23450714 |
| Molecular Formula | C9H10OS |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.05 |
| IUPAC Name | 3,4-dihydro-2H-thiochromen-2-ol |
| SMILES | OC1CCc2ccccc2S1 |
| InChI | InChI=1S/C9H10OS/c10-9-6-5-7-3-1-2-4-8(7)11-9/h1-4,9-10H,5-6H2 |
| InChIKey | LJHYYURORLFPOJ-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |