C15H18OS — CID 79224668
3-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclohex-2-en-1-ol (PubChem CID 79224668) has the molecular formula C15H18OS and a molecular weight of 246.38 g/mol. Its IUPAC name is 3-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclohex-2-en-1-ol.
| Compound Name | 3-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 79224668 |
| Molecular Formula | C15H18OS |
| Molecular Weight | 246.38 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 3-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cyclohex-2-en-1-ol |
| SMILES | OC1C=C(CC2Cc3ccccc3S2)CCC1 |
| InChI | InChI=1S/C15H18OS/c16-13-6-3-4-11(8-13)9-14-10-12-5-1-2-7-15(12)17-14/h1-2,5,7-8,13-14,16H,3-4,6,9-10H2 |
| InChIKey | SWJXNGJNPBDZSI-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.38 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|