C12H14O2S — CID 81009486
4-(2,3-dihydro-1-benzothiophen-2-yl)butanoic acid (PubChem CID 81009486) has the molecular formula C12H14O2S and a molecular weight of 222.31 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzothiophen-2-yl)butanoic acid.
| Compound Name | 4-(2,3-dihydro-1-benzothiophen-2-yl)butanoic acid |
|---|---|
| PubChem CID | 81009486 |
| Molecular Formula | C12H14O2S |
| Molecular Weight | 222.31 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | 4-(2,3-dihydro-1-benzothiophen-2-yl)butanoic acid |
| SMILES | O=C(O)CCCC1Cc2ccccc2S1 |
| InChI | InChI=1S/C12H14O2S/c13-12(14)7-3-5-10-8-9-4-1-2-6-11(9)15-10/h1-2,4,6,10H,3,5,7-8H2,(H,13,14) |
| InChIKey | IBAWSESYZMRLNH-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |