C14H18OS — CID 79224746
6-(2,3-dihydro-1-benzothiophen-2-yl)hexan-3-one (PubChem CID 79224746) has the molecular formula C14H18OS and a molecular weight of 234.36 g/mol. Its IUPAC name is 6-(2,3-dihydro-1-benzothiophen-2-yl)hexan-3-one.
| Compound Name | 6-(2,3-dihydro-1-benzothiophen-2-yl)hexan-3-one |
|---|---|
| PubChem CID | 79224746 |
| Molecular Formula | C14H18OS |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.11 |
| IUPAC Name | 6-(2,3-dihydro-1-benzothiophen-2-yl)hexan-3-one |
| SMILES | CCC(=O)CCCC1Cc2ccccc2S1 |
| InChI | InChI=1S/C14H18OS/c1-2-12(15)7-5-8-13-10-11-6-3-4-9-14(11)16-13/h3-4,6,9,13H,2,5,7-8,10H2,1H3 |
| InChIKey | WFZJELOGFJNPKD-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |