C13H18N2OS — CID 79214063
4-(2,3-dihydro-1-benzothiophen-2-ylmethylamino)butanamide (PubChem CID 79214063) has the molecular formula C13H18N2OS and a molecular weight of 250.37 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzothiophen-2-ylmethylamino)butanamide.
| Compound Name | 4-(2,3-dihydro-1-benzothiophen-2-ylmethylamino)butanamide |
|---|---|
| PubChem CID | 79214063 |
| Molecular Formula | C13H18N2OS |
| Molecular Weight | 250.37 g/mol |
| Exact Mass | 250.11 |
| IUPAC Name | 4-(2,3-dihydro-1-benzothiophen-2-ylmethylamino)butanamide |
| SMILES | NC(=O)CCCNCC1Cc2ccccc2S1 |
| InChI | InChI=1S/C13H18N2OS/c14-13(16)6-3-7-15-9-11-8-10-4-1-2-5-12(10)17-11/h1-2,4-5,11,15H,3,6-9H2,(H2,14,16) |
| InChIKey | WFFQDWGOPJKCNC-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|