C15H22ClNS — CID 114150798
5-chloro-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-methylpentan-1-amine (PubChem CID 114150798) has the molecular formula C15H22ClNS and a molecular weight of 283.87 g/mol. Its IUPAC name is 5-chloro-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-methylpentan-1-amine.
| Compound Name | 5-chloro-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-methylpentan-1-amine |
|---|---|
| PubChem CID | 114150798 |
| Molecular Formula | C15H22ClNS |
| Molecular Weight | 283.87 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | 5-chloro-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-4-methylpentan-1-amine |
| SMILES | CC(CCl)CCCNCC1Cc2ccccc2S1 |
| InChI | InChI=1S/C15H22ClNS/c1-12(10-16)5-4-8-17-11-14-9-13-6-2-3-7-15(13)18-14/h2-3,6-7,12,14,17H,4-5,8-11H2,1H3 |
| InChIKey | STGWMDKHWRTKSP-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.87 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|