C13H18BrNS — CID 83188006
4-bromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)butan-2-amine (PubChem CID 83188006) has the molecular formula C13H18BrNS and a molecular weight of 300.27 g/mol. Its IUPAC name is 4-bromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)butan-2-amine.
| Compound Name | 4-bromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)butan-2-amine |
|---|---|
| PubChem CID | 83188006 |
| Molecular Formula | C13H18BrNS |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 4-bromo-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)butan-2-amine |
| SMILES | CC(CCBr)NCC1Cc2ccccc2S1 |
| InChI | InChI=1S/C13H18BrNS/c1-10(6-7-14)15-9-12-8-11-4-2-3-5-13(11)16-12/h2-5,10,12,15H,6-9H2,1H3 |
| InChIKey | BGXOUCXGMLXIPE-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|