C12H16ClNS — CID 79224418
1-chloro-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)propan-2-amine (PubChem CID 79224418) has the molecular formula C12H16ClNS and a molecular weight of 241.79 g/mol. Its IUPAC name is 1-chloro-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)propan-2-amine.
| Compound Name | 1-chloro-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)propan-2-amine |
|---|---|
| PubChem CID | 79224418 |
| Molecular Formula | C12H16ClNS |
| Molecular Weight | 241.79 g/mol |
| Exact Mass | 241.07 |
| IUPAC Name | 1-chloro-N-(2,3-dihydro-1-benzothiophen-2-ylmethyl)propan-2-amine |
| SMILES | CC(CCl)NCC1Cc2ccccc2S1 |
| InChI | InChI=1S/C12H16ClNS/c1-9(7-13)14-8-11-6-10-4-2-3-5-12(10)15-11/h2-5,9,11,14H,6-8H2,1H3 |
| InChIKey | YBYNKBPJCJPVBX-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.79 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|