C13H16O4S2 — CID 105354377
2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfonyl)butanoic acid (PubChem CID 105354377) has the molecular formula C13H16O4S2 and a molecular weight of 300.40 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfonyl)butanoic acid.
| Compound Name | 2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfonyl)butanoic acid |
|---|---|
| PubChem CID | 105354377 |
| Molecular Formula | C13H16O4S2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.05 |
| IUPAC Name | 2-(2,3-dihydro-1-benzothiophen-2-ylmethylsulfonyl)butanoic acid |
| SMILES | CCC(C(=O)O)S(=O)(=O)CC1Cc2ccccc2S1 |
| InChI | InChI=1S/C13H16O4S2/c1-2-12(13(14)15)19(16,17)8-10-7-9-5-3-4-6-11(9)18-10/h3-6,10,12H,2,7-8H2,1H3,(H,14,15) |
| InChIKey | BICOEYOIIZUXEF-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |