C15H16N2O3S — CID 79211651
5-[5-(2,3-dihydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]pentanoic acid (PubChem CID 79211651) has the molecular formula C15H16N2O3S and a molecular weight of 304.37 g/mol. Its IUPAC name is 5-[5-(2,3-dihydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]pentanoic acid.
| Compound Name | 5-[5-(2,3-dihydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]pentanoic acid |
|---|---|
| PubChem CID | 79211651 |
| Molecular Formula | C15H16N2O3S |
| Molecular Weight | 304.37 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 5-[5-(2,3-dihydro-1-benzothiophen-2-yl)-1,3,4-oxadiazol-2-yl]pentanoic acid |
| SMILES | O=C(O)CCCCc1nnc(C2Cc3ccccc3S2)o1 |
| InChI | InChI=1S/C15H16N2O3S/c18-14(19)8-4-3-7-13-16-17-15(20-13)12-9-10-5-1-2-6-11(10)21-12/h1-2,5-6,12H,3-4,7-9H2,(H,18,19) |
| InChIKey | HCSPQRGRDAFZRP-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.37 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|