C17H17BrS — CID 79227797
2-(3-bromo-3-phenylpropyl)-2,3-dihydro-1-benzothiophene (PubChem CID 79227797) has the molecular formula C17H17BrS and a molecular weight of 333.29 g/mol. Its IUPAC name is 2-(3-bromo-3-phenylpropyl)-2,3-dihydro-1-benzothiophene.
| Compound Name | 2-(3-bromo-3-phenylpropyl)-2,3-dihydro-1-benzothiophene |
|---|---|
| PubChem CID | 79227797 |
| Molecular Formula | C17H17BrS |
| Molecular Weight | 333.29 g/mol |
| Exact Mass | 332.02 |
| IUPAC Name | 2-(3-bromo-3-phenylpropyl)-2,3-dihydro-1-benzothiophene |
| SMILES | BrC(CCC1Cc2ccccc2S1)c1ccccc1 |
| InChI | InChI=1S/C17H17BrS/c18-16(13-6-2-1-3-7-13)11-10-15-12-14-8-4-5-9-17(14)19-15/h1-9,15-16H,10-12H2 |
| InChIKey | UMZRHDIQHVEECI-UHFFFAOYSA-N |
| XLogP | 5.62 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.29 |
| LogP ≤ 5 | 5.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|