C13H17BrS — CID 79228756
2-(3-bromo-2-methylbutyl)-2,3-dihydro-1-benzothiophene (PubChem CID 79228756) has the molecular formula C13H17BrS and a molecular weight of 285.25 g/mol. Its IUPAC name is 2-(3-bromo-2-methylbutyl)-2,3-dihydro-1-benzothiophene.
| Compound Name | 2-(3-bromo-2-methylbutyl)-2,3-dihydro-1-benzothiophene |
|---|---|
| PubChem CID | 79228756 |
| Molecular Formula | C13H17BrS |
| Molecular Weight | 285.25 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | 2-(3-bromo-2-methylbutyl)-2,3-dihydro-1-benzothiophene |
| SMILES | CC(Br)C(C)CC1Cc2ccccc2S1 |
| InChI | InChI=1S/C13H17BrS/c1-9(10(2)14)7-12-8-11-5-3-4-6-13(11)15-12/h3-6,9-10,12H,7-8H2,1-2H3 |
| InChIKey | FQKNNDDIMOUPAM-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.25 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|