C14H19NS — CID 18545992
1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)piperidine (PubChem CID 18545992) has the molecular formula C14H19NS and a molecular weight of 233.38 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)piperidine.
| Compound Name | 1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)piperidine |
|---|---|
| PubChem CID | 18545992 |
| Molecular Formula | C14H19NS |
| Molecular Weight | 233.38 g/mol |
| Exact Mass | 233.12 |
| IUPAC Name | 1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)piperidine |
| SMILES | c1ccc2c(c1)CC(CN1CCCCC1)S2 |
| InChI | InChI=1S/C14H19NS/c1-4-8-15(9-5-1)11-13-10-12-6-2-3-7-14(12)16-13/h2-3,6-7,13H,1,4-5,8-11H2 |
| InChIKey | DDNZUYRZPONOFZ-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.38 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |