C15H20ClNS — CID 79223787
2-(chloromethyl)-1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)piperidine (PubChem CID 79223787) has the molecular formula C15H20ClNS and a molecular weight of 281.85 g/mol. Its IUPAC name is 2-(chloromethyl)-1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)piperidine.
| Compound Name | 2-(chloromethyl)-1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)piperidine |
|---|---|
| PubChem CID | 79223787 |
| Molecular Formula | C15H20ClNS |
| Molecular Weight | 281.85 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | 2-(chloromethyl)-1-(2,3-dihydro-1-benzothiophen-2-ylmethyl)piperidine |
| SMILES | ClCC1CCCCN1CC1Cc2ccccc2S1 |
| InChI | InChI=1S/C15H20ClNS/c16-10-13-6-3-4-8-17(13)11-14-9-12-5-1-2-7-15(12)18-14/h1-2,5,7,13-14H,3-4,6,8-11H2 |
| InChIKey | JUVLTHFUDZZHQC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.85 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|