About 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-1,4-thiazepane
4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-1,4-thiazepane (PubChem CID 79315028) has the molecular formula C14H19NS2
and a molecular weight of 265.45 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-1,4-thiazepane.
Molecular Properties
| Compound Name | 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-1,4-thiazepane |
| PubChem CID | 79315028 |
| Molecular Formula | C14H19NS2 |
| Molecular Weight | 265.45 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-1,4-thiazepane |
| SMILES | c1ccc2c(c1)CC(CN1CCCSCC1)S2 |
| InChI | InChI=1S/C14H19NS2/c1-2-5-14-12(4-1)10-13(17-14)11-15-6-3-8-16-9-7-15/h1-2,4-5,13H,3,6-11H2 |
| InChIKey | JCWSABQDUKKIHL-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.45 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-1,4-thiazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-1,4-thiazepane?
The IUPAC name of 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-1,4-thiazepane (CID 79315028) is 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-1,4-thiazepane.
What is the SMILES notation for 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-1,4-thiazepane?
The canonical SMILES for 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-1,4-thiazepane is c1ccc2c(c1)CC(CN1CCCSCC1)S2.
What is the InChIKey of 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-1,4-thiazepane?
The InChIKey is JCWSABQDUKKIHL-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19NS2/c1-2-5-14-12(4-1)10-13(17-14)11-15-6-3-8-16-9-7-15/h1-2,4-5,13H,3,6-11H2.
What are the key properties of 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-1,4-thiazepane?
4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-1,4-thiazepane has a molecular weight of 265.45 g/mol, XLogP of 3.14, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,3-dihydro-1-benzothiophen-2-ylmethyl)-1,4-thiazepane is sourced from PubChem (CID 79315028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).