C16H22OS — CID 79227348
2-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cycloheptan-1-ol (PubChem CID 79227348) has the molecular formula C16H22OS and a molecular weight of 262.42 g/mol. Its IUPAC name is 2-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cycloheptan-1-ol.
| Compound Name | 2-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cycloheptan-1-ol |
|---|---|
| PubChem CID | 79227348 |
| Molecular Formula | C16H22OS |
| Molecular Weight | 262.42 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 2-(2,3-dihydro-1-benzothiophen-2-ylmethyl)cycloheptan-1-ol |
| SMILES | OC1CCCCCC1CC1Cc2ccccc2S1 |
| InChI | InChI=1S/C16H22OS/c17-15-8-3-1-2-6-12(15)10-14-11-13-7-4-5-9-16(13)18-14/h4-5,7,9,12,14-15,17H,1-3,6,8,10-11H2 |
| InChIKey | OFGTZRAILSKYIX-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |