C19H19BrS — CID 79227947
2-[(1-bromo-1,2,3,4-tetrahydronaphthalen-2-yl)methyl]-2,3-dihydro-1-benzothiophene (PubChem CID 79227947) has the molecular formula C19H19BrS and a molecular weight of 359.33 g/mol. Its IUPAC name is 2-[(1-bromo-1,2,3,4-tetrahydronaphthalen-2-yl)methyl]-2,3-dihydro-1-benzothiophene.
| Compound Name | 2-[(1-bromo-1,2,3,4-tetrahydronaphthalen-2-yl)methyl]-2,3-dihydro-1-benzothiophene |
|---|---|
| PubChem CID | 79227947 |
| Molecular Formula | C19H19BrS |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 358.04 |
| IUPAC Name | 2-[(1-bromo-1,2,3,4-tetrahydronaphthalen-2-yl)methyl]-2,3-dihydro-1-benzothiophene |
| SMILES | BrC1c2ccccc2CCC1CC1Cc2ccccc2S1 |
| InChI | InChI=1S/C19H19BrS/c20-19-15(10-9-13-5-1-3-7-17(13)19)12-16-11-14-6-2-4-8-18(14)21-16/h1-8,15-16,19H,9-12H2 |
| InChIKey | WJDBUNMCAQHTCG-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|