C16H14S — CID 10847548
5,6,6a,11a-tetrahydronaphtho[1,2-b][1]benzothiole (PubChem CID 10847548) has the molecular formula C16H14S and a molecular weight of 238.36 g/mol. Its IUPAC name is 5,6,6a,11a-tetrahydronaphtho[1,2-b][1]benzothiole.
| Compound Name | 5,6,6a,11a-tetrahydronaphtho[1,2-b][1]benzothiole |
|---|---|
| PubChem CID | 10847548 |
| Molecular Formula | C16H14S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 5,6,6a,11a-tetrahydronaphtho[1,2-b][1]benzothiole |
| SMILES | c1ccc2c(c1)CCC1c3ccccc3SC21 |
| InChI | InChI=1S/C16H14S/c1-2-6-12-11(5-1)9-10-14-13-7-3-4-8-15(13)17-16(12)14/h1-8,14,16H,9-10H2 |
| InChIKey | SUHPFRHKONGTSX-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |