C25H26O2S — CID 161115006
2,3,4,4a,9,9a-hexahydrofluoren-1-one;2,3,4a,9b-tetrahydro-1H-dibenzothiophen-4-one (PubChem CID 161115006) has the molecular formula C25H26O2S and a molecular weight of 390.55 g/mol. Its IUPAC name is 2,3,4,4a,9,9a-hexahydrofluoren-1-one;2,3,4a,9b-tetrahydro-1H-dibenzothiophen-4-one.
| Compound Name | 2,3,4,4a,9,9a-hexahydrofluoren-1-one;2,3,4a,9b-tetrahydro-1H-dibenzothiophen-4-one |
|---|---|
| PubChem CID | 161115006 |
| Molecular Formula | C25H26O2S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.17 |
| IUPAC Name | 2,3,4,4a,9,9a-hexahydrofluoren-1-one;2,3,4a,9b-tetrahydro-1H-dibenzothiophen-4-one |
| SMILES | O=C1CCCC2c3ccccc3CC12.O=C1CCCC2c3ccccc3SC12 |
| InChI | InChI=1S/C13H14O.C12H12OS/c14-13-7-3-6-11-10-5-2-1-4-9(10)8-12(11)13;13-10-6-3-5-9-8-4-1-2-7-11(8)14-12(9)10/h1-2,4-5,11-12H,3,6-8H2;1-2,4,7,9,12H,3,5-6H2 |
| InChIKey | UKEVHMMCENLMQC-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |