C20H29BO4 — CID 15196692
(4S,5S)-4,5-bis(1-methoxycyclopentyl)-2-phenyl-1,3,2-dioxaborolane (PubChem CID 15196692) has the molecular formula C20H29BO4 and a molecular weight of 344.26 g/mol. Its IUPAC name is (4S,5S)-4,5-bis(1-methoxycyclopentyl)-2-phenyl-1,3,2-dioxaborolane.
| Compound Name | (4S,5S)-4,5-bis(1-methoxycyclopentyl)-2-phenyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 15196692 |
| Molecular Formula | C20H29BO4 |
| Molecular Weight | 344.26 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (4S,5S)-4,5-bis(1-methoxycyclopentyl)-2-phenyl-1,3,2-dioxaborolane |
| SMILES | COC1([C@H]2OB(c3ccccc3)O[C@@H]2C2(OC)CCCC2)CCCC1 |
| InChI | InChI=1S/C20H29BO4/c1-22-19(12-6-7-13-19)17-18(20(23-2)14-8-9-15-20)25-21(24-17)16-10-4-3-5-11-16/h3-5,10-11,17-18H,6-9,12-15H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | IUEKSBDMZLUGPC-ROUUACIJSA-N |
| XLogP | 3.08 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.26 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|