C30H40BNO4 — CID 10553044
N-benzyl-3-[(4R,5R)-4,5-bis(1-methoxycyclopentyl)-1,3,2-dioxaborolan-2-yl]-1-phenylpropan-1-imine (PubChem CID 10553044) has the molecular formula C30H40BNO4 and a molecular weight of 489.47 g/mol. Its IUPAC name is N-benzyl-3-[(4R,5R)-4,5-bis(1-methoxycyclopentyl)-1,3,2-dioxaborolan-2-yl]-1-phenylpropan-1-imine.
| Compound Name | N-benzyl-3-[(4R,5R)-4,5-bis(1-methoxycyclopentyl)-1,3,2-dioxaborolan-2-yl]-1-phenylpropan-1-imine |
|---|---|
| PubChem CID | 10553044 |
| Molecular Formula | C30H40BNO4 |
| Molecular Weight | 489.47 g/mol |
| Exact Mass | 489.31 |
| IUPAC Name | N-benzyl-3-[(4R,5R)-4,5-bis(1-methoxycyclopentyl)-1,3,2-dioxaborolan-2-yl]-1-phenylpropan-1-imine |
| SMILES | COC1([C@@H]2OB(CC/C(=N\Cc3ccccc3)c3ccccc3)O[C@H]2C2(OC)CCCC2)CCCC1 |
| InChI | InChI=1S/C30H40BNO4/c1-33-29(18-9-10-19-29)27-28(30(34-2)20-11-12-21-30)36-31(35-27)22-17-26(25-15-7-4-8-16-25)32-23-24-13-5-3-6-14-24/h3-8,13-16,27-28H,9-12,17-23H2,1-2H3/b32-26+/t27-,28-/m1/s1 |
| InChIKey | QEFDHGQKAZXJLO-IBRQINKPSA-N |
| XLogP | 6.26 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.47 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|