C16H22O3 — CID 71453915
3-benzyl-3-methoxy-1,2-dioxaspiro[4.5]decane (PubChem CID 71453915) has the molecular formula C16H22O3 and a molecular weight of 262.35 g/mol. Its IUPAC name is 3-benzyl-3-methoxy-1,2-dioxaspiro[4.5]decane.
| Compound Name | 3-benzyl-3-methoxy-1,2-dioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 71453915 |
| Molecular Formula | C16H22O3 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.16 |
| IUPAC Name | 3-benzyl-3-methoxy-1,2-dioxaspiro[4.5]decane |
| SMILES | COC1(Cc2ccccc2)CC2(CCCCC2)OO1 |
| InChI | InChI=1S/C16H22O3/c1-17-16(12-14-8-4-2-5-9-14)13-15(18-19-16)10-6-3-7-11-15/h2,4-5,8-9H,3,6-7,10-13H2,1H3 |
| InChIKey | SHMUUDNMAWESDP-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|