C12H13BO3 — CID 123171099
3-phenyl-2,4-dioxa-3-borabicyclo[3.3.1]nonan-7-one (PubChem CID 123171099) has the molecular formula C12H13BO3 and a molecular weight of 216.05 g/mol. Its IUPAC name is 3-phenyl-2,4-dioxa-3-borabicyclo[3.3.1]nonan-7-one.
| Compound Name | 3-phenyl-2,4-dioxa-3-borabicyclo[3.3.1]nonan-7-one |
|---|---|
| PubChem CID | 123171099 |
| Molecular Formula | C12H13BO3 |
| Molecular Weight | 216.05 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | 3-phenyl-2,4-dioxa-3-borabicyclo[3.3.1]nonan-7-one |
| SMILES | O=C1CC2CC(C1)OB(c1ccccc1)O2 |
| InChI | InChI=1S/C12H13BO3/c14-10-6-11-8-12(7-10)16-13(15-11)9-4-2-1-3-5-9/h1-5,11-12H,6-8H2 |
| InChIKey | FYXVFXWGWUXREB-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.05 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|