C9H11BO3 — CID 25062374
2-phenyl-1,3,2-dioxaborinan-5-ol (PubChem CID 25062374) has the molecular formula C9H11BO3 and a molecular weight of 178.00 g/mol. Its IUPAC name is 2-phenyl-1,3,2-dioxaborinan-5-ol.
| Compound Name | 2-phenyl-1,3,2-dioxaborinan-5-ol |
|---|---|
| PubChem CID | 25062374 |
| Molecular Formula | C9H11BO3 |
| Molecular Weight | 178.00 g/mol |
| Exact Mass | 178.08 |
| IUPAC Name | 2-phenyl-1,3,2-dioxaborinan-5-ol |
| SMILES | OC1COB(c2ccccc2)OC1 |
| InChI | InChI=1S/C9H11BO3/c11-9-6-12-10(13-7-9)8-4-2-1-3-5-8/h1-5,9,11H,6-7H2 |
| InChIKey | XETZALCKYDYUBO-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.00 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|