C24H23B3O6 — CID 16678015
(4R,4aS,8aS)-2,6-diphenyl-4-[(4S)-2-phenyl-1,3,2-dioxaborolan-4-yl]-4,4a,8,8a-tetrahydro-[1,3,2]dioxaborinino[5,4-d][1,3,2]dioxaborinine (PubChem CID 16678015) has the molecular formula C24H23B3O6 and a molecular weight of 439.88 g/mol. Its IUPAC name is (4R,4aS,8aS)-2,6-diphenyl-4-[(4S)-2-phenyl-1,3,2-dioxaborolan-4-yl]-4,4a,8,8a-tetrahydro-[1,3,2]dioxaborinino[5,4-d][1,3,2]dioxaborinine.
| Compound Name | (4R,4aS,8aS)-2,6-diphenyl-4-[(4S)-2-phenyl-1,3,2-dioxaborolan-4-yl]-4,4a,8,8a-tetrahydro-[1,3,2]dioxaborinino[5,4-d][1,3,2]dioxaborinine |
|---|---|
| PubChem CID | 16678015 |
| Molecular Formula | C24H23B3O6 |
| Molecular Weight | 439.88 g/mol |
| Exact Mass | 440.18 |
| IUPAC Name | (4R,4aS,8aS)-2,6-diphenyl-4-[(4S)-2-phenyl-1,3,2-dioxaborolan-4-yl]-4,4a,8,8a-tetrahydro-[1,3,2]dioxaborinino[5,4-d][1,3,2]dioxaborinine |
| SMILES | c1ccc(B2OC[C@@H]3OB(c4ccccc4)O[C@H]([C@@H]4COB(c5ccccc5)O4)[C@H]3O2)cc1 |
| InChI | InChI=1S/C24H23B3O6/c1-4-10-18(11-5-1)25-28-16-21(30-25)24-23-22(31-27(33-24)20-14-8-3-9-15-20)17-29-26(32-23)19-12-6-2-7-13-19/h1-15,21-24H,16-17H2/t21-,22-,23-,24+/m0/s1 |
| InChIKey | FBFPLFGAIISYPJ-NEWJYFPISA-N |
| XLogP | 0.79 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.88 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|