C15H17BO6 — CID 53307520
4-[(1S,2R,6R,8R)-4,4-dimethyl-3,5,7,10,12-pentaoxa-11-boratricyclo[6.4.0.02,6]dodecan-11-yl]benzaldehyde (PubChem CID 53307520) has the molecular formula C15H17BO6 and a molecular weight of 304.11 g/mol. Its IUPAC name is 4-[(1S,2R,6R,8R)-4,4-dimethyl-3,5,7,10,12-pentaoxa-11-boratricyclo[6.4.0.02,6]dodecan-11-yl]benzaldehyde.
| Compound Name | 4-[(1S,2R,6R,8R)-4,4-dimethyl-3,5,7,10,12-pentaoxa-11-boratricyclo[6.4.0.02,6]dodecan-11-yl]benzaldehyde |
|---|---|
| PubChem CID | 53307520 |
| Molecular Formula | C15H17BO6 |
| Molecular Weight | 304.11 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 4-[(1S,2R,6R,8R)-4,4-dimethyl-3,5,7,10,12-pentaoxa-11-boratricyclo[6.4.0.02,6]dodecan-11-yl]benzaldehyde |
| SMILES | CC1(C)O[C@H]2O[C@@H]3COB(c4ccc(C=O)cc4)O[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C15H17BO6/c1-15(2)20-13-12-11(19-14(13)21-15)8-18-16(22-12)10-5-3-9(7-17)4-6-10/h3-7,11-14H,8H2,1-2H3/t11-,12+,13-,14-/m1/s1 |
| InChIKey | BZXORPZZDQMONB-XJFOESAGSA-N |
| XLogP | 0.49 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.11 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|