C9H12O5S — CID 10911415
(1S,2R,6R,8R)-4,4-dimethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-11-thione (PubChem CID 10911415) has the molecular formula C9H12O5S and a molecular weight of 232.26 g/mol. Its IUPAC name is (1S,2R,6R,8R)-4,4-dimethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-11-thione.
| Compound Name | (1S,2R,6R,8R)-4,4-dimethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-11-thione |
|---|---|
| PubChem CID | 10911415 |
| Molecular Formula | C9H12O5S |
| Molecular Weight | 232.26 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | (1S,2R,6R,8R)-4,4-dimethyl-3,5,7,10,12-pentaoxatricyclo[6.4.0.02,6]dodecane-11-thione |
| SMILES | CC1(C)O[C@H]2O[C@@H]3COC(=S)O[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C9H12O5S/c1-9(2)13-6-5-4(11-7(6)14-9)3-10-8(15)12-5/h4-7H,3H2,1-2H3/t4-,5+,6-,7-/m1/s1 |
| InChIKey | KHOMZZGNOQYJEG-XZBKPIIZSA-N |
| XLogP | 0.56 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.26 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|