C10H14O5S — CID 100965985
(4R)-4-[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-dioxolane-2-thione (PubChem CID 100965985) has the molecular formula C10H14O5S and a molecular weight of 246.28 g/mol. Its IUPAC name is (4R)-4-[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-dioxolane-2-thione.
| Compound Name | (4R)-4-[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-dioxolane-2-thione |
|---|---|
| PubChem CID | 100965985 |
| Molecular Formula | C10H14O5S |
| Molecular Weight | 246.28 g/mol |
| Exact Mass | 246.06 |
| IUPAC Name | (4R)-4-[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-1,3-dioxolane-2-thione |
| SMILES | CC1(C)O[C@H]2O[C@H]([C@H]3COC(=S)O3)C[C@H]2O1 |
| InChI | InChI=1S/C10H14O5S/c1-10(2)14-6-3-5(12-8(6)15-10)7-4-11-9(16)13-7/h5-8H,3-4H2,1-2H3/t5-,6+,7+,8+/m0/s1 |
| InChIKey | JRUJGFJXAVZZNJ-LXGUWJNJSA-N |
| XLogP | 0.95 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.28 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|