C8H13NO4 — CID 130765029
(3aR,5R,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carboxamide (PubChem CID 130765029) has the molecular formula C8H13NO4 and a molecular weight of 187.19 g/mol. Its IUPAC name is (3aR,5R,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carboxamide.
| Compound Name | (3aR,5R,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carboxamide |
|---|---|
| PubChem CID | 130765029 |
| Molecular Formula | C8H13NO4 |
| Molecular Weight | 187.19 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | (3aR,5R,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole-5-carboxamide |
| SMILES | CC1(C)O[C@H]2O[C@@H](C(N)=O)C[C@H]2O1 |
| InChI | InChI=1S/C8H13NO4/c1-8(2)12-5-3-4(6(9)10)11-7(5)13-8/h4-5,7H,3H2,1-2H3,(H2,9,10)/t4-,5-,7-/m1/s1 |
| InChIKey | JNBQTQFYTTVUQL-WYDQCIBASA-N |
| XLogP | -0.26 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.19 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |