C13H23NO6 — CID 89151474
(3aR)-7-(2-methoxypropan-2-yloxy)-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-carboxamide (PubChem CID 89151474) has the molecular formula C13H23NO6 and a molecular weight of 289.33 g/mol. Its IUPAC name is (3aR)-7-(2-methoxypropan-2-yloxy)-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-carboxamide.
| Compound Name | (3aR)-7-(2-methoxypropan-2-yloxy)-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-carboxamide |
|---|---|
| PubChem CID | 89151474 |
| Molecular Formula | C13H23NO6 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | (3aR)-7-(2-methoxypropan-2-yloxy)-2,2-dimethyl-5,6,7,7a-tetrahydro-3aH-[1,3]dioxolo[4,5-b]pyran-5-carboxamide |
| SMILES | COC(C)(C)OC1CC(C(N)=O)O[C@@H]2OC(C)(C)OC12 |
| InChI | InChI=1S/C13H23NO6/c1-12(2,16-5)18-7-6-8(10(14)15)17-11-9(7)19-13(3,4)20-11/h7-9,11H,6H2,1-5H3,(H2,14,15)/t7?,8?,9?,11-/m1/s1 |
| InChIKey | CXBPKBKFDFCQAJ-AWAZGIPZSA-N |
| XLogP | 0.51 |
| TPSA | 89.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|