C14H24O5 — CID 138675121
(3S)-3-[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,2-dimethylpentanoic acid (PubChem CID 138675121) has the molecular formula C14H24O5 and a molecular weight of 272.34 g/mol. Its IUPAC name is (3S)-3-[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,2-dimethylpentanoic acid.
| Compound Name | (3S)-3-[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,2-dimethylpentanoic acid |
|---|---|
| PubChem CID | 138675121 |
| Molecular Formula | C14H24O5 |
| Molecular Weight | 272.34 g/mol |
| Exact Mass | 272.16 |
| IUPAC Name | (3S)-3-[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]-2,2-dimethylpentanoic acid |
| SMILES | CC[C@H]([C@@H]1C[C@H]2OC(C)(C)O[C@H]2O1)C(C)(C)C(=O)O |
| InChI | InChI=1S/C14H24O5/c1-6-8(13(2,3)12(15)16)9-7-10-11(17-9)19-14(4,5)18-10/h8-11H,6-7H2,1-5H3,(H,15,16)/t8-,9+,10-,11-/m1/s1 |
| InChIKey | MXCDUUARUKMEDO-LMLFDSFASA-N |
| XLogP | 2.39 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |