C10H17FO3 — CID 157100750
(3aR,5S,6aR)-5-[(2R)-1-fluoropropan-2-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 157100750) has the molecular formula C10H17FO3 and a molecular weight of 204.24 g/mol. Its IUPAC name is (3aR,5S,6aR)-5-[(2R)-1-fluoropropan-2-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5S,6aR)-5-[(2R)-1-fluoropropan-2-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 157100750 |
| Molecular Formula | C10H17FO3 |
| Molecular Weight | 204.24 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (3aR,5S,6aR)-5-[(2R)-1-fluoropropan-2-yl]-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | C[C@@H](CF)[C@@H]1C[C@H]2OC(C)(C)O[C@H]2O1 |
| InChI | InChI=1S/C10H17FO3/c1-6(5-11)7-4-8-9(12-7)14-10(2,3)13-8/h6-9H,4-5H2,1-3H3/t6-,7-,8+,9+/m0/s1 |
| InChIKey | HHNLPEIMBLWXTI-RBXMUDONSA-N |
| XLogP | 1.86 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.24 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |