C10H15F3O6S — CID 11162981
[(1R)-1-[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethyl] trifluoromethanesulfonate (PubChem CID 11162981) has the molecular formula C10H15F3O6S and a molecular weight of 320.29 g/mol. Its IUPAC name is [(1R)-1-[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethyl] trifluoromethanesulfonate.
| Compound Name | [(1R)-1-[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11162981 |
| Molecular Formula | C10H15F3O6S |
| Molecular Weight | 320.29 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | [(1R)-1-[(3aR,5S,6aR)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxol-5-yl]ethyl] trifluoromethanesulfonate |
| SMILES | C[C@@H](OS(=O)(=O)C(F)(F)F)[C@@H]1C[C@H]2OC(C)(C)O[C@H]2O1 |
| InChI | InChI=1S/C10H15F3O6S/c1-5(19-20(14,15)10(11,12)13)6-4-7-8(16-6)18-9(2,3)17-7/h5-8H,4H2,1-3H3/t5-,6+,7-,8-/m1/s1 |
| InChIKey | BZDITVALQLOTMG-ULAWRXDQSA-N |
| XLogP | 1.51 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.29 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|