C11H14O4 — CID 14261516
(3aR,5R,6aR)-5-(furan-3-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole (PubChem CID 14261516) has the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. Its IUPAC name is (3aR,5R,6aR)-5-(furan-3-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole.
| Compound Name | (3aR,5R,6aR)-5-(furan-3-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
|---|---|
| PubChem CID | 14261516 |
| Molecular Formula | C11H14O4 |
| Molecular Weight | 210.23 g/mol |
| Exact Mass | 210.09 |
| IUPAC Name | (3aR,5R,6aR)-5-(furan-3-yl)-2,2-dimethyl-3a,5,6,6a-tetrahydrofuro[2,3-d][1,3]dioxole |
| SMILES | CC1(C)O[C@H]2O[C@@H](c3ccoc3)C[C@H]2O1 |
| InChI | InChI=1S/C11H14O4/c1-11(2)14-9-5-8(13-10(9)15-11)7-3-4-12-6-7/h3-4,6,8-10H,5H2,1-2H3/t8-,9-,10-/m1/s1 |
| InChIKey | DDMOQTHLKVUABP-OPRDCNLKSA-N |
| XLogP | 2.22 |
| TPSA | 40.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.23 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |