C19H20O6 — CID 101297631
(1S,3R,5S,6R,8R,11S,12S,13S)-3-(furan-3-yl)-5-methyl-2,9,14-trioxapentacyclo[11.2.1.18,11.01,5.06,12]heptadecane-10,15-dione (PubChem CID 101297631) has the molecular formula C19H20O6 and a molecular weight of 344.36 g/mol. Its IUPAC name is (1S,3R,5S,6R,8R,11S,12S,13S)-3-(furan-3-yl)-5-methyl-2,9,14-trioxapentacyclo[11.2.1.18,11.01,5.06,12]heptadecane-10,15-dione.
| Compound Name | (1S,3R,5S,6R,8R,11S,12S,13S)-3-(furan-3-yl)-5-methyl-2,9,14-trioxapentacyclo[11.2.1.18,11.01,5.06,12]heptadecane-10,15-dione |
|---|---|
| PubChem CID | 101297631 |
| Molecular Formula | C19H20O6 |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | (1S,3R,5S,6R,8R,11S,12S,13S)-3-(furan-3-yl)-5-methyl-2,9,14-trioxapentacyclo[11.2.1.18,11.01,5.06,12]heptadecane-10,15-dione |
| SMILES | C[C@@]12C[C@H](c3ccoc3)O[C@@]13C[C@H](OC3=O)[C@@H]1[C@@H]3C[C@@H](C[C@H]12)OC3=O |
| InChI | InChI=1S/C19H20O6/c1-18-6-13(9-2-3-22-8-9)25-19(18)7-14(24-17(19)21)15-11-4-10(5-12(15)18)23-16(11)20/h2-3,8,10-15H,4-7H2,1H3/t10-,11-,12+,13+,14-,15+,18-,19+/m0/s1 |
| InChIKey | QEANLIISUSNNDX-QLDJHULOSA-N |
| XLogP | 2.38 |
| TPSA | 74.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |